C7H14N2S — CID 10607039
3a-methylsulfanyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole (PubChem CID 10607039) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 3a-methylsulfanyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 3a-methylsulfanyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 10607039 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3a-methylsulfanyl-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole |
| SMILES | CSC12CCNC1CNC2 |
| InChI | InChI=1S/C7H14N2S/c1-10-7-2-3-9-6(7)4-8-5-7/h6,8-9H,2-5H2,1H3 |
| InChIKey | GHYIJRJDWNELKH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |