About (4R)-4-ethyl-2-pentyl-1,3-oxazolidine
(4R)-4-ethyl-2-pentyl-1,3-oxazolidine (PubChem CID 10607282) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (4R)-4-ethyl-2-pentyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4R)-4-ethyl-2-pentyl-1,3-oxazolidine |
| PubChem CID | 10607282 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (4R)-4-ethyl-2-pentyl-1,3-oxazolidine |
| SMILES | CCCCCC1N[C@H](CC)CO1 |
| InChI | InChI=1S/C10H21NO/c1-3-5-6-7-10-11-9(4-2)8-12-10/h9-11H,3-8H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | WOLYUTIIHOODES-YHMJZVADSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-ethyl-2-pentyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-ethyl-2-pentyl-1,3-oxazolidine?
The IUPAC name of (4R)-4-ethyl-2-pentyl-1,3-oxazolidine (CID 10607282) is (4R)-4-ethyl-2-pentyl-1,3-oxazolidine.
What is the SMILES notation for (4R)-4-ethyl-2-pentyl-1,3-oxazolidine?
The canonical SMILES for (4R)-4-ethyl-2-pentyl-1,3-oxazolidine is CCCCCC1N[C@H](CC)CO1.
What is the InChIKey of (4R)-4-ethyl-2-pentyl-1,3-oxazolidine?
The InChIKey is WOLYUTIIHOODES-YHMJZVADSA-N. The full InChI is InChI=1S/C10H21NO/c1-3-5-6-7-10-11-9(4-2)8-12-10/h9-11H,3-8H2,1-2H3/t9-,10?/m1/s1.
What are the key properties of (4R)-4-ethyl-2-pentyl-1,3-oxazolidine?
(4R)-4-ethyl-2-pentyl-1,3-oxazolidine has a molecular weight of 171.28 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-ethyl-2-pentyl-1,3-oxazolidine is sourced from PubChem (CID 10607282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).