About 2-propyl-4-tridecyl-1,3-oxazolidine
2-propyl-4-tridecyl-1,3-oxazolidine (PubChem CID 66910843) has the molecular formula C19H39NO
and a molecular weight of 297.53 g/mol. Its IUPAC name is 2-propyl-4-tridecyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-propyl-4-tridecyl-1,3-oxazolidine |
| PubChem CID | 66910843 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 2-propyl-4-tridecyl-1,3-oxazolidine |
| SMILES | CCCCCCCCCCCCCC1COC(CCC)N1 |
| InChI | InChI=1S/C19H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-16-18-17-21-19(20-18)15-4-2/h18-20H,3-17H2,1-2H3 |
| InChIKey | NFRISKVBWSYWHE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-4-tridecyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-4-tridecyl-1,3-oxazolidine?
The IUPAC name of 2-propyl-4-tridecyl-1,3-oxazolidine (CID 66910843) is 2-propyl-4-tridecyl-1,3-oxazolidine.
What is the SMILES notation for 2-propyl-4-tridecyl-1,3-oxazolidine?
The canonical SMILES for 2-propyl-4-tridecyl-1,3-oxazolidine is CCCCCCCCCCCCCC1COC(CCC)N1.
What is the InChIKey of 2-propyl-4-tridecyl-1,3-oxazolidine?
The InChIKey is NFRISKVBWSYWHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO/c1-3-5-6-7-8-9-10-11-12-13-14-16-18-17-21-19(20-18)15-4-2/h18-20H,3-17H2,1-2H3.
What are the key properties of 2-propyl-4-tridecyl-1,3-oxazolidine?
2-propyl-4-tridecyl-1,3-oxazolidine has a molecular weight of 297.53 g/mol, XLogP of 5.80, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-4-tridecyl-1,3-oxazolidine is sourced from PubChem (CID 66910843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).