C12H21N3O2S — CID 106074785
3-(ethylaminomethyl)-N',N',4-trimethylbenzenesulfonohydrazide (PubChem CID 106074785) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-N',N',4-trimethylbenzenesulfonohydrazide.
| Compound Name | 3-(ethylaminomethyl)-N',N',4-trimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 106074785 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-(ethylaminomethyl)-N',N',4-trimethylbenzenesulfonohydrazide |
| SMILES | CCNCc1cc(S(=O)(=O)NN(C)C)ccc1C |
| InChI | InChI=1S/C12H21N3O2S/c1-5-13-9-11-8-12(7-6-10(11)2)18(16,17)14-15(3)4/h6-8,13-14H,5,9H2,1-4H3 |
| InChIKey | UITGZLYQGHGKHM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|