C11H17Cl2N3O2S — CID 106074981
2,4-dichloro-5-(ethylaminomethyl)-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 106074981) has the molecular formula C11H17Cl2N3O2S and a molecular weight of 326.25 g/mol. Its IUPAC name is 2,4-dichloro-5-(ethylaminomethyl)-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 2,4-dichloro-5-(ethylaminomethyl)-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 106074981 |
| Molecular Formula | C11H17Cl2N3O2S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2,4-dichloro-5-(ethylaminomethyl)-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CCNCc1cc(S(=O)(=O)NN(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H17Cl2N3O2S/c1-4-14-7-8-5-11(10(13)6-9(8)12)19(17,18)15-16(2)3/h5-6,14-15H,4,7H2,1-3H3 |
| InChIKey | BPISONCPEMJPAD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|