C10H14N2O2 — CID 10607849
pent-2-ynyl 1,4,5,6-tetrahydropyrimidine-5-carboxylate (PubChem CID 10607849) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is pent-2-ynyl 1,4,5,6-tetrahydropyrimidine-5-carboxylate.
| Compound Name | pent-2-ynyl 1,4,5,6-tetrahydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10607849 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | pent-2-ynyl 1,4,5,6-tetrahydropyrimidine-5-carboxylate |
| SMILES | CCC#CCOC(=O)C1CN=CNC1 |
| InChI | InChI=1S/C10H14N2O2/c1-2-3-4-5-14-10(13)9-6-11-8-12-7-9/h8-9H,2,5-7H2,1H3,(H,11,12) |
| InChIKey | BKTFLHAWKROZPI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|