C11H14N2O2 — CID 10198169
[(Z)-3-methylpent-2-en-4-ynyl] 1,4,5,6-tetrahydropyrimidine-5-carboxylate (PubChem CID 10198169) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is [(Z)-3-methylpent-2-en-4-ynyl] 1,4,5,6-tetrahydropyrimidine-5-carboxylate.
| Compound Name | [(Z)-3-methylpent-2-en-4-ynyl] 1,4,5,6-tetrahydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10198169 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [(Z)-3-methylpent-2-en-4-ynyl] 1,4,5,6-tetrahydropyrimidine-5-carboxylate |
| SMILES | C#C/C(C)=C\COC(=O)C1CN=CNC1 |
| InChI | InChI=1S/C11H14N2O2/c1-3-9(2)4-5-15-11(14)10-6-12-8-13-7-10/h1,4,8,10H,5-7H2,2H3,(H,12,13)/b9-4- |
| InChIKey | PBPSOMFALSXIFM-WTKPLQERSA-N |
| XLogP | 0.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|