C15H33N3O2S — CID 106079132
N-(3,3-dimethylbutan-2-yl)-2-(propylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106079132) has the molecular formula C15H33N3O2S and a molecular weight of 319.52 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2-(propylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2-(propylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106079132 |
| Molecular Formula | C15H33N3O2S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2-(propylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CCCNCC1CCCCN1S(=O)(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C15H33N3O2S/c1-6-10-16-12-14-9-7-8-11-18(14)21(19,20)17-13(2)15(3,4)5/h13-14,16-17H,6-12H2,1-5H3 |
| InChIKey | ZMKKKOMCNJJTGJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|