C11H23F2N3O2S — CID 115409161
N-(2,2-difluoroethyl)-2-(propylaminomethyl)piperidine-1-sulfonamide (PubChem CID 115409161) has the molecular formula C11H23F2N3O2S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(propylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-2-(propylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115409161 |
| Molecular Formula | C11H23F2N3O2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(propylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CCCNCC1CCCCN1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C11H23F2N3O2S/c1-2-6-14-8-10-5-3-4-7-16(10)19(17,18)15-9-11(12)13/h10-11,14-15H,2-9H2,1H3 |
| InChIKey | QSTWCQGMAUWHCL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|