C13H25F3N2O2S — CID 83047909
N-[[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methyl]propan-1-amine (PubChem CID 83047909) has the molecular formula C13H25F3N2O2S and a molecular weight of 330.42 g/mol. Its IUPAC name is N-[[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 83047909 |
| Molecular Formula | C13H25F3N2O2S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N2O2S/c1-2-8-17-11-12-6-3-4-9-18(12)21(19,20)10-5-7-13(14,15)16/h12,17H,2-11H2,1H3 |
| InChIKey | IQLGHDSZXYSWRW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|