C10H16F3NO3S — CID 83058257
1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carbaldehyde (PubChem CID 83058257) has the molecular formula C10H16F3NO3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carbaldehyde.
| Compound Name | 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 83058257 |
| Molecular Formula | C10H16F3NO3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3S/c11-10(12,13)5-3-7-18(16,17)14-6-2-1-4-9(14)8-15/h8-9H,1-7H2 |
| InChIKey | LEICXENDXUUDMF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|