C11H20F3NO3S — CID 83059717
1-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-2-ol (PubChem CID 83059717) has the molecular formula C11H20F3NO3S and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-2-ol.
| Compound Name | 1-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 83059717 |
| Molecular Formula | C11H20F3NO3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO3S/c1-9(16)8-10-4-2-6-15(10)19(17,18)7-3-5-11(12,13)14/h9-10,16H,2-8H2,1H3 |
| InChIKey | PFWMVADZYLSUIW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |