C8H5N5O2 — CID 10608205
11-nitro-6,7-diaza-2-azonia-3-azanidatricyclo[6.4.0.02,6]dodeca-1,4,7,9,11-pentaene (PubChem CID 10608205) has the molecular formula C8H5N5O2 and a molecular weight of 203.16 g/mol. Its IUPAC name is 11-nitro-6,7-diaza-2-azonia-3-azanidatricyclo[6.4.0.02,6]dodeca-1,4,7,9,11-pentaene.
| Compound Name | 11-nitro-6,7-diaza-2-azonia-3-azanidatricyclo[6.4.0.02,6]dodeca-1,4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10608205 |
| Molecular Formula | C8H5N5O2 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 11-nitro-6,7-diaza-2-azonia-3-azanidatricyclo[6.4.0.02,6]dodeca-1,4,7,9,11-pentaene |
| SMILES | O=[N+]([O-])c1ccc2nn3cc[n-][n+]3c2c1 |
| InChI | InChI=1S/C8H5N5O2/c14-13(15)6-1-2-7-8(5-6)12-9-3-4-11(12)10-7/h1-5H |
| InChIKey | WLCXQOAMNWDERD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|