C6H3N3O3S — CID 102493706
5-nitro-3-oxido-2,1,3-benzothiadiazol-3-ium (PubChem CID 102493706) has the molecular formula C6H3N3O3S and a molecular weight of 197.18 g/mol. Its IUPAC name is 5-nitro-3-oxido-2,1,3-benzothiadiazol-3-ium.
| Compound Name | 5-nitro-3-oxido-2,1,3-benzothiadiazol-3-ium |
|---|---|
| PubChem CID | 102493706 |
| Molecular Formula | C6H3N3O3S |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-nitro-3-oxido-2,1,3-benzothiadiazol-3-ium |
| SMILES | O=[N+]([O-])c1ccc2ns[n+]([O-])c2c1 |
| InChI | InChI=1S/C6H3N3O3S/c10-8(11)4-1-2-5-6(3-4)9(12)13-7-5/h1-3H |
| InChIKey | KGWQAIAXBIZXDH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|