C10H16N6O2S — CID 106084971
1-(2-aminoethyl)-N-[1-(1H-imidazol-2-yl)ethyl]pyrazole-4-sulfonamide (PubChem CID 106084971) has the molecular formula C10H16N6O2S and a molecular weight of 284.35 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[1-(1H-imidazol-2-yl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-[1-(1H-imidazol-2-yl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106084971 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-(2-aminoethyl)-N-[1-(1H-imidazol-2-yl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cnn(CCN)c1)c1ncc[nH]1 |
| InChI | InChI=1S/C10H16N6O2S/c1-8(10-12-3-4-13-10)15-19(17,18)9-6-14-16(7-9)5-2-11/h3-4,6-8,15H,2,5,11H2,1H3,(H,12,13) |
| InChIKey | GTXIYODKAFHNPJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |