C8H14N2O5 — CID 10608838
(1R,2S,3R,4R)-1-(1H-imidazol-5-yl)pentane-1,2,3,4,5-pentol (PubChem CID 10608838) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is (1R,2S,3R,4R)-1-(1H-imidazol-5-yl)pentane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,3R,4R)-1-(1H-imidazol-5-yl)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10608838 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1R,2S,3R,4R)-1-(1H-imidazol-5-yl)pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)c1cnc[nH]1 |
| InChI | InChI=1S/C8H14N2O5/c11-2-5(12)7(14)8(15)6(13)4-1-9-3-10-4/h1,3,5-8,11-15H,2H2,(H,9,10)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | HPHOKCBXEWWILR-XUTVFYLZSA-N |
| XLogP | -2.48 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |