C5H8N2O2 — CID 54365092
1-(1H-imidazol-5-yl)ethane-1,2-diol (PubChem CID 54365092) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)ethane-1,2-diol.
| Compound Name | 1-(1H-imidazol-5-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 54365092 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 1-(1H-imidazol-5-yl)ethane-1,2-diol |
| SMILES | OCC(O)c1cnc[nH]1 |
| InChI | InChI=1S/C5H8N2O2/c8-2-5(9)4-1-6-3-7-4/h1,3,5,8-9H,2H2,(H,6,7) |
| InChIKey | UPFSGNMBAPULTH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |