C13H24N4O2S2 — CID 106089228
5-methyl-3-(propylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 106089228) has the molecular formula C13H24N4O2S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is 5-methyl-3-(propylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(propylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106089228 |
| Molecular Formula | C13H24N4O2S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-methyl-3-(propylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCCNCc1n[nH]c(C)c1S(=O)(=O)NCC1CCSC1 |
| InChI | InChI=1S/C13H24N4O2S2/c1-3-5-14-8-12-13(10(2)16-17-12)21(18,19)15-7-11-4-6-20-9-11/h11,14-15H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | FZKODTQSVWUKQH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|