C12H18N4O2S3 — CID 106089734
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106089734) has the molecular formula C12H18N4O2S3 and a molecular weight of 346.50 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106089734 |
| Molecular Formula | C12H18N4O2S3 |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-5-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1cc(S(=O)(=O)Nc2nnc(CC)s2)cs1 |
| InChI | InChI=1S/C12H18N4O2S3/c1-3-5-13-7-9-6-10(8-19-9)21(17,18)16-12-15-14-11(4-2)20-12/h6,8,13H,3-5,7H2,1-2H3,(H,15,16) |
| InChIKey | AVGGKSXJEVMSNR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|