C12H19BrN2O3S2 — CID 106090522
5-(aminomethyl)-2-bromo-N-[(1-methylsulfanylcyclopentyl)methyl]furan-3-sulfonamide (PubChem CID 106090522) has the molecular formula C12H19BrN2O3S2 and a molecular weight of 383.33 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[(1-methylsulfanylcyclopentyl)methyl]furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[(1-methylsulfanylcyclopentyl)methyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106090522 |
| Molecular Formula | C12H19BrN2O3S2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[(1-methylsulfanylcyclopentyl)methyl]furan-3-sulfonamide |
| SMILES | CSC1(CNS(=O)(=O)c2cc(CN)oc2Br)CCCC1 |
| InChI | InChI=1S/C12H19BrN2O3S2/c1-19-12(4-2-3-5-12)8-15-20(16,17)10-6-9(7-14)18-11(10)13/h6,15H,2-5,7-8,14H2,1H3 |
| InChIKey | UIPIPEUOJVUJER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |