C13H22N2O2S3 — CID 106090814
4-(methylaminomethyl)-N-(4-methylsulfanylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 106090814) has the molecular formula C13H22N2O2S3 and a molecular weight of 334.53 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(4-methylsulfanylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(4-methylsulfanylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106090814 |
| Molecular Formula | C13H22N2O2S3 |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-(methylaminomethyl)-N-(4-methylsulfanylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CNCc1csc(S(=O)(=O)NC2CCC(SC)CC2)c1 |
| InChI | InChI=1S/C13H22N2O2S3/c1-14-8-10-7-13(19-9-10)20(16,17)15-11-3-5-12(18-2)6-4-11/h7,9,11-12,14-15H,3-6,8H2,1-2H3 |
| InChIKey | PTFAHTQAXVQQKB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |