C10H16N2O2S3 — CID 106084527
4-(aminomethyl)-N-(thian-4-yl)thiophene-2-sulfonamide (PubChem CID 106084527) has the molecular formula C10H16N2O2S3 and a molecular weight of 292.45 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(thian-4-yl)thiophene-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(thian-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106084527 |
| Molecular Formula | C10H16N2O2S3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-(aminomethyl)-N-(thian-4-yl)thiophene-2-sulfonamide |
| SMILES | NCc1csc(S(=O)(=O)NC2CCSCC2)c1 |
| InChI | InChI=1S/C10H16N2O2S3/c11-6-8-5-10(16-7-8)17(13,14)12-9-1-3-15-4-2-9/h5,7,9,12H,1-4,6,11H2 |
| InChIKey | MOSMMKVQDZTCMO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |