C9H14N2O4 — CID 106103142
3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 106103142) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106103142 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1OCCC1(O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H14N2O4/c1-6-9(14,2-3-15-6)5-11-7(12)4-10-8(11)13/h6,14H,2-5H2,1H3,(H,10,13) |
| InChIKey | GLJHCLZUDCPYEJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|