C10H15NO4S — CID 106103089
4-[(3-hydroxy-2-methyloxolan-3-yl)methyl]thiomorpholine-3,5-dione (PubChem CID 106103089) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methyloxolan-3-yl)methyl]thiomorpholine-3,5-dione.
| Compound Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methyl]thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 106103089 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methyl]thiomorpholine-3,5-dione |
| SMILES | CC1OCCC1(O)CN1C(=O)CSCC1=O |
| InChI | InChI=1S/C10H15NO4S/c1-7-10(14,2-3-15-7)6-11-8(12)4-16-5-9(11)13/h7,14H,2-6H2,1H3 |
| InChIKey | DMDNKTNSNUXZGW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|