C9H11NO4S — CID 104570524
1-[(3,5-dioxothiomorpholin-4-yl)methyl]cyclopropane-1-carboxylic acid (PubChem CID 104570524) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is 1-[(3,5-dioxothiomorpholin-4-yl)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(3,5-dioxothiomorpholin-4-yl)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 104570524 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1-[(3,5-dioxothiomorpholin-4-yl)methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C1CSCC(=O)N1CC1(C(=O)O)CC1 |
| InChI | InChI=1S/C9H11NO4S/c11-6-3-15-4-7(12)10(6)5-9(1-2-9)8(13)14/h1-5H2,(H,13,14) |
| InChIKey | RFPDBLHOWUJAEM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|