1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid

C9H13NO4 — CID 115446001

IUPAC1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid
SMILESO=C1OCCN1CC1(C(=O)O)CCC1
InChIInChI=1S/C9H13NO4/c11-7(12)9(2-1-3-9)6-10-4-5-14-8(10)13/h1-6H2,(H,11,12)
InChIKeyLGXOMOLEAZAIDU-UHFFFAOYSA-N
MW199.21 g/mol
LogP0.69
Rot. Bonds3

About 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid

1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 115446001) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid
PubChem CID115446001
Molecular FormulaC9H13NO4
Molecular Weight199.21 g/mol
Exact Mass199.08
IUPAC Name1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid
SMILESO=C1OCCN1CC1(C(=O)O)CCC1
InChIInChI=1S/C9H13NO4/c11-7(12)9(2-1-3-9)6-10-4-5-14-8(10)13/h1-6H2,(H,11,12)
InChIKeyLGXOMOLEAZAIDU-UHFFFAOYSA-N
XLogP0.69
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 50.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid (CID 115446001) is 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid is O=C1OCCN1CC1(C(=O)O)CCC1.
What is the InChIKey of 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid?
The InChIKey is LGXOMOLEAZAIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c11-7(12)9(2-1-3-9)6-10-4-5-14-8(10)13/h1-6H2,(H,11,12).
What are the key properties of 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid?
1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid has a molecular weight of 199.21 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-oxo-1,3-oxazolidin-3-yl)methyl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 115446001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).