C9H15NO4 — CID 104550613
3-[(4-hydroxyoxan-4-yl)methyl]-1,3-oxazolidin-2-one (PubChem CID 104550613) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 3-[(4-hydroxyoxan-4-yl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(4-hydroxyoxan-4-yl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 104550613 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-[(4-hydroxyoxan-4-yl)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CC1(O)CCOCC1 |
| InChI | InChI=1S/C9H15NO4/c11-8-10(3-6-14-8)7-9(12)1-4-13-5-2-9/h12H,1-7H2 |
| InChIKey | BFBWPTOFHSTTHE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |