C12H19NO4 — CID 113269057
1-[(4-hydroxyoxan-4-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 113269057) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(4-hydroxyoxan-4-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 113269057 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-[(4-hydroxyoxan-4-yl)methyl]-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CC2(O)CCOCC2)C(=O)C1C |
| InChI | InChI=1S/C12H19NO4/c1-8-9(2)11(15)13(10(8)14)7-12(16)3-5-17-6-4-12/h8-9,16H,3-7H2,1-2H3 |
| InChIKey | QHURBZGIUPCWLC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|