C16H21NO4 — CID 115436017
1-[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 115436017) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115436017 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C1C2CC=CCC2C(=O)N1CC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C16H21NO4/c18-13-11-6-2-3-7-12(11)14(19)17(13)10-16(15(20)21)8-4-1-5-9-16/h2-3,11-12H,1,4-10H2,(H,20,21) |
| InChIKey | KRBFCECHJHXQGP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|