C13H19NO4S — CID 113427880
1-[(3,5-dioxothiomorpholin-4-yl)methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 113427880) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-[(3,5-dioxothiomorpholin-4-yl)methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(3,5-dioxothiomorpholin-4-yl)methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 113427880 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[(3,5-dioxothiomorpholin-4-yl)methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(CN2C(=O)CSCC2=O)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H19NO4S/c1-9-2-4-13(5-3-9,12(17)18)8-14-10(15)6-19-7-11(14)16/h9H,2-8H2,1H3,(H,17,18) |
| InChIKey | FODDOIRIXKQJFG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|