C12H9F2NO5 — CID 106108327
3-(5,6-difluoro-1,3-dioxoisoindol-2-yl)-2-methoxypropanoic acid (PubChem CID 106108327) has the molecular formula C12H9F2NO5 and a molecular weight of 285.20 g/mol. Its IUPAC name is 3-(5,6-difluoro-1,3-dioxoisoindol-2-yl)-2-methoxypropanoic acid.
| Compound Name | 3-(5,6-difluoro-1,3-dioxoisoindol-2-yl)-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106108327 |
| Molecular Formula | C12H9F2NO5 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-(5,6-difluoro-1,3-dioxoisoindol-2-yl)-2-methoxypropanoic acid |
| SMILES | COC(CN1C(=O)c2cc(F)c(F)cc2C1=O)C(=O)O |
| InChI | InChI=1S/C12H9F2NO5/c1-20-9(12(18)19)4-15-10(16)5-2-7(13)8(14)3-6(5)11(15)17/h2-3,9H,4H2,1H3,(H,18,19) |
| InChIKey | SAIFPFPAIGMYAD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|