C12H23N3O — CID 106114233
3-[[1-(1H-pyrazol-5-yl)ethylamino]methyl]hexan-1-ol (PubChem CID 106114233) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-[[1-(1H-pyrazol-5-yl)ethylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[1-(1H-pyrazol-5-yl)ethylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106114233 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-[[1-(1H-pyrazol-5-yl)ethylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNC(C)c1ccn[nH]1 |
| InChI | InChI=1S/C12H23N3O/c1-3-4-11(6-8-16)9-13-10(2)12-5-7-14-15-12/h5,7,10-11,13,16H,3-4,6,8-9H2,1-2H3,(H,14,15) |
| InChIKey | PATCRZVFAKIMCP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |