C8H20N2O2 — CID 106115064
2-methoxy-N'-(2-methoxypropyl)propane-1,3-diamine (PubChem CID 106115064) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-methoxy-N'-(2-methoxypropyl)propane-1,3-diamine.
| Compound Name | 2-methoxy-N'-(2-methoxypropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106115064 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 2-methoxy-N'-(2-methoxypropyl)propane-1,3-diamine |
| SMILES | COC(C)CNCC(CN)OC |
| InChI | InChI=1S/C8H20N2O2/c1-7(11-2)5-10-6-8(4-9)12-3/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | KMFZYZBKPZWTPK-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |