C14H18BrClN2O3 — CID 106118239
N-[2-(2-bromoethyl)pentyl]-2-chloro-6-nitrobenzamide (PubChem CID 106118239) has the molecular formula C14H18BrClN2O3 and a molecular weight of 377.67 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-2-chloro-6-nitrobenzamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-2-chloro-6-nitrobenzamide |
|---|---|
| PubChem CID | 106118239 |
| Molecular Formula | C14H18BrClN2O3 |
| Molecular Weight | 377.67 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-2-chloro-6-nitrobenzamide |
| SMILES | CCCC(CCBr)CNC(=O)c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18BrClN2O3/c1-2-4-10(7-8-15)9-17-14(19)13-11(16)5-3-6-12(13)18(20)21/h3,5-6,10H,2,4,7-9H2,1H3,(H,17,19) |
| InChIKey | PATWYBWVAGYDII-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|