C13H18F2N2O — CID 106119943
3-[(4-amino-2,6-difluoroanilino)methyl]cyclohexan-1-ol (PubChem CID 106119943) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[(4-amino-2,6-difluoroanilino)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(4-amino-2,6-difluoroanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106119943 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[(4-amino-2,6-difluoroanilino)methyl]cyclohexan-1-ol |
| SMILES | Nc1cc(F)c(NCC2CCCC(O)C2)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c14-11-5-9(16)6-12(15)13(11)17-7-8-2-1-3-10(18)4-8/h5-6,8,10,17-18H,1-4,7,16H2 |
| InChIKey | VDOJJKJSBSCNPR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|