C13H18BrFN2O3S — CID 106119387
5-amino-3-bromo-2-fluoro-N-[(3-hydroxycyclohexyl)methyl]benzenesulfonamide (PubChem CID 106119387) has the molecular formula C13H18BrFN2O3S and a molecular weight of 381.27 g/mol. Its IUPAC name is 5-amino-3-bromo-2-fluoro-N-[(3-hydroxycyclohexyl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-3-bromo-2-fluoro-N-[(3-hydroxycyclohexyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106119387 |
| Molecular Formula | C13H18BrFN2O3S |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-amino-3-bromo-2-fluoro-N-[(3-hydroxycyclohexyl)methyl]benzenesulfonamide |
| SMILES | Nc1cc(Br)c(F)c(S(=O)(=O)NCC2CCCC(O)C2)c1 |
| InChI | InChI=1S/C13H18BrFN2O3S/c14-11-5-9(16)6-12(13(11)15)21(19,20)17-7-8-2-1-3-10(18)4-8/h5-6,8,10,17-18H,1-4,7,16H2 |
| InChIKey | WIPFUJLWGRLALN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|