C12H16BrNO5S2 — CID 106120610
5-bromo-4-[(3-hydroxycyclohexyl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106120610) has the molecular formula C12H16BrNO5S2 and a molecular weight of 398.30 g/mol. Its IUPAC name is 5-bromo-4-[(3-hydroxycyclohexyl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(3-hydroxycyclohexyl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106120610 |
| Molecular Formula | C12H16BrNO5S2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 5-bromo-4-[(3-hydroxycyclohexyl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2CCCC(O)C2)c(Br)s1 |
| InChI | InChI=1S/C12H16BrNO5S2/c13-11-10(5-9(20-11)12(16)17)21(18,19)14-6-7-2-1-3-8(15)4-7/h5,7-8,14-15H,1-4,6H2,(H,16,17) |
| InChIKey | ZWGVCQIJOYPGBZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |