C13H14F5NO — CID 106129529
3-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol (PubChem CID 106129529) has the molecular formula C13H14F5NO and a molecular weight of 295.25 g/mol. Its IUPAC name is 3-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106129529 |
| Molecular Formula | C13H14F5NO |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNc2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C13H14F5NO/c14-8-9(15)11(17)13(12(18)10(8)16)19-5-6-2-1-3-7(20)4-6/h6-7,19-20H,1-5H2 |
| InChIKey | WKWBBDICJZZPMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|