C12H16F2N2O2S — CID 106125576
N-[(3-aminocyclopentyl)methyl]-2,4-difluorobenzenesulfonamide (PubChem CID 106125576) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.33 g/mol. Its IUPAC name is N-[(3-aminocyclopentyl)methyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[(3-aminocyclopentyl)methyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106125576 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[(3-aminocyclopentyl)methyl]-2,4-difluorobenzenesulfonamide |
| SMILES | NC1CCC(CNS(=O)(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C12H16F2N2O2S/c13-9-2-4-12(11(14)6-9)19(17,18)16-7-8-1-3-10(15)5-8/h2,4,6,8,10,16H,1,3,5,7,15H2 |
| InChIKey | OHVPWNAJXXYRIK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |