C14H19ClFNO2S — CID 106136234
N-[(4-chlorocyclohexyl)methyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 106136234) has the molecular formula C14H19ClFNO2S and a molecular weight of 319.83 g/mol. Its IUPAC name is N-[(4-chlorocyclohexyl)methyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[(4-chlorocyclohexyl)methyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106136234 |
| Molecular Formula | C14H19ClFNO2S |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[(4-chlorocyclohexyl)methyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCC1CCC(Cl)CC1 |
| InChI | InChI=1S/C14H19ClFNO2S/c1-10-8-13(16)6-7-14(10)20(18,19)17-9-11-2-4-12(15)5-3-11/h6-8,11-12,17H,2-5,9H2,1H3 |
| InChIKey | YOODZMKBCQSTNT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|