C11H14BrN3O2 — CID 106128896
N-[(3-bromocyclopentyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 106128896) has the molecular formula C11H14BrN3O2 and a molecular weight of 300.16 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 106128896 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCC1CCC(Br)C1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C11H14BrN3O2/c12-8-2-1-7(5-8)6-13-11(17)9-3-4-10(16)15-14-9/h3-4,7-8H,1-2,5-6H2,(H,13,17)(H,15,16) |
| InChIKey | MHDYPNBWVLDEIU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|