C14H19N3O4 — CID 108745197
methyl 2-[[(6-oxo-1H-pyridazine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108745197) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl 2-[[(6-oxo-1H-pyridazine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[(6-oxo-1H-pyridazine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108745197 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 2-[[(6-oxo-1H-pyridazine-3-carbonyl)amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C14H19N3O4/c1-21-14(20)10-5-3-2-4-9(10)8-15-13(19)11-6-7-12(18)17-16-11/h6-7,9-10H,2-5,8H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | AUEMLTCBMYJJEI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |