About methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate
methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108745195) has the molecular formula C17H21Cl2NO4
and a molecular weight of 374.26 g/mol. Its IUPAC name is methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate |
| PubChem CID | 108745195 |
| Molecular Formula | C17H21Cl2NO4 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)c1c(Cl)ccc(Cl)c1OC |
| InChI | InChI=1S/C17H21Cl2NO4/c1-23-15-13(19)8-7-12(18)14(15)16(21)20-9-10-5-3-4-6-11(10)17(22)24-2/h7-8,10-11H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | HTWNLMYCHFYPBI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate?
The IUPAC name of methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate (CID 108745195) is methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate is COC(=O)C1CCCCC1CNC(=O)c1c(Cl)ccc(Cl)c1OC.
What is the InChIKey of methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate?
The InChIKey is HTWNLMYCHFYPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2NO4/c1-23-15-13(19)8-7-12(18)14(15)16(21)20-9-10-5-3-4-6-11(10)17(22)24-2/h7-8,10-11H,3-6,9H2,1-2H3,(H,20,21).
What are the key properties of methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate?
methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate has a molecular weight of 374.26 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3,6-dichloro-2-methoxybenzoyl)amino]methyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 108745195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).