C16H19ClFNO3 — CID 108745251
methyl 2-[[(2-chloro-6-fluorobenzoyl)amino]methyl]cyclohexane-1-carboxylate (PubChem CID 108745251) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is methyl 2-[[(2-chloro-6-fluorobenzoyl)amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[(2-chloro-6-fluorobenzoyl)amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 108745251 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | methyl 2-[[(2-chloro-6-fluorobenzoyl)amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H19ClFNO3/c1-22-16(21)11-6-3-2-5-10(11)9-19-15(20)14-12(17)7-4-8-13(14)18/h4,7-8,10-11H,2-3,5-6,9H2,1H3,(H,19,20) |
| InChIKey | UDLIOYDAPBZVEK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |