C12H19FN4 — CID 106129104
N-[(4-aminocyclohexyl)methyl]-5-fluoro-6-methylpyrimidin-4-amine (PubChem CID 106129104) has the molecular formula C12H19FN4 and a molecular weight of 238.31 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-5-fluoro-6-methylpyrimidin-4-amine.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-5-fluoro-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106129104 |
| Molecular Formula | C12H19FN4 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-5-fluoro-6-methylpyrimidin-4-amine |
| SMILES | Cc1ncnc(NCC2CCC(N)CC2)c1F |
| InChI | InChI=1S/C12H19FN4/c1-8-11(13)12(17-7-16-8)15-6-9-2-4-10(14)5-3-9/h7,9-10H,2-6,14H2,1H3,(H,15,16,17) |
| InChIKey | VWSKPOKQRLAJFN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |