C17H26F3N3 — CID 15334552
N-(4-tert-butylcyclohexyl)-6-ethyl-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 15334552) has the molecular formula C17H26F3N3 and a molecular weight of 329.41 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-6-ethyl-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(4-tert-butylcyclohexyl)-6-ethyl-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 15334552 |
| Molecular Formula | C17H26F3N3 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-6-ethyl-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCc1ncnc(NC2CCC(C(C)(C)C)CC2)c1C(F)(F)F |
| InChI | InChI=1S/C17H26F3N3/c1-5-13-14(17(18,19)20)15(22-10-21-13)23-12-8-6-11(7-9-12)16(2,3)4/h10-12H,5-9H2,1-4H3,(H,21,22,23) |
| InChIKey | FTIUGGCLOAEUHS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |