C8H16BrNO4S2 — CID 106135072
N-[(3-bromocyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 106135072) has the molecular formula C8H16BrNO4S2 and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 106135072 |
| Molecular Formula | C8H16BrNO4S2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NCC1CCC(Br)C1 |
| InChI | InChI=1S/C8H16BrNO4S2/c1-15(11,12)6-16(13,14)10-5-7-2-3-8(9)4-7/h7-8,10H,2-6H2,1H3 |
| InChIKey | CAFSJELJZRUUEI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|