C16H21NO4 — CID 10613529
methyl (E,2S,5R)-2-methyl-5-(phenylmethoxycarbonylamino)hex-3-enoate (PubChem CID 10613529) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl (E,2S,5R)-2-methyl-5-(phenylmethoxycarbonylamino)hex-3-enoate.
| Compound Name | methyl (E,2S,5R)-2-methyl-5-(phenylmethoxycarbonylamino)hex-3-enoate |
|---|---|
| PubChem CID | 10613529 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (E,2S,5R)-2-methyl-5-(phenylmethoxycarbonylamino)hex-3-enoate |
| SMILES | COC(=O)[C@@H](C)/C=C/[C@@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-12(15(18)20-3)9-10-13(2)17-16(19)21-11-14-7-5-4-6-8-14/h4-10,12-13H,11H2,1-3H3,(H,17,19)/b10-9+/t12-,13+/m0/s1 |
| InChIKey | BRIJDVYAEIJSJQ-CCJARXIYSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|