C16H21NO5 — CID 10709858
methyl (E,2S,5S)-2-methoxy-5-(phenylmethoxycarbonylamino)hex-3-enoate (PubChem CID 10709858) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl (E,2S,5S)-2-methoxy-5-(phenylmethoxycarbonylamino)hex-3-enoate.
| Compound Name | methyl (E,2S,5S)-2-methoxy-5-(phenylmethoxycarbonylamino)hex-3-enoate |
|---|---|
| PubChem CID | 10709858 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl (E,2S,5S)-2-methoxy-5-(phenylmethoxycarbonylamino)hex-3-enoate |
| SMILES | COC(=O)[C@H](/C=C/[C@H](C)NC(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C16H21NO5/c1-12(9-10-14(20-2)15(18)21-3)17-16(19)22-11-13-7-5-4-6-8-13/h4-10,12,14H,11H2,1-3H3,(H,17,19)/b10-9+/t12-,14-/m0/s1 |
| InChIKey | HHOQALPAMBLXHE-OKWZRIHXSA-N |
| XLogP | 2.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|