About N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine
N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine (PubChem CID 10613848) has the molecular formula C14H12N6O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine |
| PubChem CID | 10613848 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine |
| SMILES | O=[N+]([O-])c1ccc(N(Cc2ccccn2)n2cnnc2)cc1 |
| InChI | InChI=1S/C14H12N6O2/c21-20(22)14-6-4-13(5-7-14)19(18-10-16-17-11-18)9-12-3-1-2-8-15-12/h1-8,10-11H,9H2 |
| InChIKey | ILOCWDXNIWDBRV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine?
The IUPAC name of N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine (CID 10613848) is N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine?
The canonical SMILES for N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine is O=[N+]([O-])c1ccc(N(Cc2ccccn2)n2cnnc2)cc1.
What is the InChIKey of N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine?
The InChIKey is ILOCWDXNIWDBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O2/c21-20(22)14-6-4-13(5-7-14)19(18-10-16-17-11-18)9-12-3-1-2-8-15-12/h1-8,10-11H,9H2.
What are the key properties of N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine?
N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine has a molecular weight of 296.29 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-nitrophenyl)-N-(pyridin-2-ylmethyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 10613848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).